C16H22ClNO2 — CID 64739402
2-(4-chloro-N-(3,4-dimethylcyclohexyl)anilino)acetic acid (PubChem CID 64739402) has the molecular formula C16H22ClNO2 and a molecular weight of 295.81 g/mol. Its IUPAC name is 2-(4-chloro-N-(3,4-dimethylcyclohexyl)anilino)acetic acid.
| Compound Name | 2-(4-chloro-N-(3,4-dimethylcyclohexyl)anilino)acetic acid |
|---|---|
| PubChem CID | 64739402 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 2-(4-chloro-N-(3,4-dimethylcyclohexyl)anilino)acetic acid |
| SMILES | CC1CCC(N(CC(=O)O)c2ccc(Cl)cc2)CC1C |
| InChI | InChI=1S/C16H22ClNO2/c1-11-3-6-15(9-12(11)2)18(10-16(19)20)14-7-4-13(17)5-8-14/h4-5,7-8,11-12,15H,3,6,9-10H2,1-2H3,(H,19,20) |
| InChIKey | OBPLJASEAALECP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |