C15H21NO2 — CID 65059121
2-(4-methyl-N-(3-methylcyclopentyl)anilino)acetic acid (PubChem CID 65059121) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-(4-methyl-N-(3-methylcyclopentyl)anilino)acetic acid.
| Compound Name | 2-(4-methyl-N-(3-methylcyclopentyl)anilino)acetic acid |
|---|---|
| PubChem CID | 65059121 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 2-(4-methyl-N-(3-methylcyclopentyl)anilino)acetic acid |
| SMILES | Cc1ccc(N(CC(=O)O)C2CCC(C)C2)cc1 |
| InChI | InChI=1S/C15H21NO2/c1-11-3-6-13(7-4-11)16(10-15(17)18)14-8-5-12(2)9-14/h3-4,6-7,12,14H,5,8-10H2,1-2H3,(H,17,18) |
| InChIKey | HWQQGYDTBZEUAG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|