C18H27NO2 — CID 64728856
3-(N-(3,5-dimethylcyclohexyl)-4-methylanilino)propanoic acid (PubChem CID 64728856) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 3-(N-(3,5-dimethylcyclohexyl)-4-methylanilino)propanoic acid.
| Compound Name | 3-(N-(3,5-dimethylcyclohexyl)-4-methylanilino)propanoic acid |
|---|---|
| PubChem CID | 64728856 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 3-(N-(3,5-dimethylcyclohexyl)-4-methylanilino)propanoic acid |
| SMILES | Cc1ccc(N(CCC(=O)O)C2CC(C)CC(C)C2)cc1 |
| InChI | InChI=1S/C18H27NO2/c1-13-4-6-16(7-5-13)19(9-8-18(20)21)17-11-14(2)10-15(3)12-17/h4-7,14-15,17H,8-12H2,1-3H3,(H,20,21) |
| InChIKey | DSABIOLPGUEYPK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|