C14H19NO5S — CID 60884039
3-(N-(4-hydroxy-1,1-dioxothiolan-3-yl)-4-methylanilino)propanoic acid (PubChem CID 60884039) has the molecular formula C14H19NO5S and a molecular weight of 313.38 g/mol. Its IUPAC name is 3-(N-(4-hydroxy-1,1-dioxothiolan-3-yl)-4-methylanilino)propanoic acid.
| Compound Name | 3-(N-(4-hydroxy-1,1-dioxothiolan-3-yl)-4-methylanilino)propanoic acid |
|---|---|
| PubChem CID | 60884039 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 3-(N-(4-hydroxy-1,1-dioxothiolan-3-yl)-4-methylanilino)propanoic acid |
| SMILES | Cc1ccc(N(CCC(=O)O)C2CS(=O)(=O)CC2O)cc1 |
| InChI | InChI=1S/C14H19NO5S/c1-10-2-4-11(5-3-10)15(7-6-14(17)18)12-8-21(19,20)9-13(12)16/h2-5,12-13,16H,6-9H2,1H3,(H,17,18) |
| InChIKey | UZFSGHZMZKBSEF-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|