C17H24ClNO2 — CID 65087089
2-(4-chloro-N-(4-ethylcycloheptyl)anilino)acetic acid (PubChem CID 65087089) has the molecular formula C17H24ClNO2 and a molecular weight of 309.84 g/mol. Its IUPAC name is 2-(4-chloro-N-(4-ethylcycloheptyl)anilino)acetic acid.
| Compound Name | 2-(4-chloro-N-(4-ethylcycloheptyl)anilino)acetic acid |
|---|---|
| PubChem CID | 65087089 |
| Molecular Formula | C17H24ClNO2 |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-(4-chloro-N-(4-ethylcycloheptyl)anilino)acetic acid |
| SMILES | CCC1CCCC(N(CC(=O)O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H24ClNO2/c1-2-13-4-3-5-15(9-6-13)19(12-17(20)21)16-10-7-14(18)8-11-16/h7-8,10-11,13,15H,2-6,9,12H2,1H3,(H,20,21) |
| InChIKey | NYNNYBXQSBBRBO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |