C13H16BrNO4S2 — CID 52541834
4-bromo-N-cyclopropyl-N-[(3R)-1,1-dioxothiolan-3-yl]benzenesulfonamide (PubChem CID 52541834) has the molecular formula C13H16BrNO4S2 and a molecular weight of 394.31 g/mol. Its IUPAC name is 4-bromo-N-cyclopropyl-N-[(3R)-1,1-dioxothiolan-3-yl]benzenesulfonamide.
| Compound Name | 4-bromo-N-cyclopropyl-N-[(3R)-1,1-dioxothiolan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 52541834 |
| Molecular Formula | C13H16BrNO4S2 |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 392.97 |
| IUPAC Name | 4-bromo-N-cyclopropyl-N-[(3R)-1,1-dioxothiolan-3-yl]benzenesulfonamide |
| SMILES | O=S1(=O)CC[C@@H](N(C2CC2)S(=O)(=O)c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C13H16BrNO4S2/c14-10-1-5-13(6-2-10)21(18,19)15(11-3-4-11)12-7-8-20(16,17)9-12/h1-2,5-6,11-12H,3-4,7-9H2/t12-/m1/s1 |
| InChIKey | FDHQNEZBYWXXGN-GFCCVEGCSA-N |
| XLogP | 1.79 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |