C17H25NO6S2 — CID 55578389
N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)-3,4-diethoxybenzenesulfonamide (PubChem CID 55578389) has the molecular formula C17H25NO6S2 and a molecular weight of 403.52 g/mol. Its IUPAC name is N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)-3,4-diethoxybenzenesulfonamide.
| Compound Name | N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)-3,4-diethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 55578389 |
| Molecular Formula | C17H25NO6S2 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)-3,4-diethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(C2CC2)C2CCS(=O)(=O)C2)cc1OCC |
| InChI | InChI=1S/C17H25NO6S2/c1-3-23-16-8-7-15(11-17(16)24-4-2)26(21,22)18(13-5-6-13)14-9-10-25(19,20)12-14/h7-8,11,13-14H,3-6,9-10,12H2,1-2H3 |
| InChIKey | JVWWOSHPMRPFNR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |