C28H38N4O12S4 — CID 164663221
N-[3-[[(5-acetamido-2-ethoxyphenyl)sulfonyl-(1,1-dioxothiolan-3-yl)amino]-(1,1-dioxothiolan-3-yl)sulfamoyl]-4-ethoxyphenyl]acetamide (PubChem CID 164663221) has the molecular formula C28H38N4O12S4 and a molecular weight of 750.90 g/mol. Its IUPAC name is N-[3-[[(5-acetamido-2-ethoxyphenyl)sulfonyl-(1,1-dioxothiolan-3-yl)amino]-(1,1-dioxothiolan-3-yl)sulfamoyl]-4-ethoxyphenyl]acetamide.
| Compound Name | N-[3-[[(5-acetamido-2-ethoxyphenyl)sulfonyl-(1,1-dioxothiolan-3-yl)amino]-(1,1-dioxothiolan-3-yl)sulfamoyl]-4-ethoxyphenyl]acetamide |
|---|---|
| PubChem CID | 164663221 |
| Molecular Formula | C28H38N4O12S4 |
| Molecular Weight | 750.90 g/mol |
| Exact Mass | 750.14 |
| IUPAC Name | N-[3-[[(5-acetamido-2-ethoxyphenyl)sulfonyl-(1,1-dioxothiolan-3-yl)amino]-(1,1-dioxothiolan-3-yl)sulfamoyl]-4-ethoxyphenyl]acetamide |
| SMILES | CCOc1ccc(NC(C)=O)cc1S(=O)(=O)N(C1CCS(=O)(=O)C1)N(C1CCS(=O)(=O)C1)S(=O)(=O)c1cc(NC(C)=O)ccc1OCC |
| InChI | InChI=1S/C28H38N4O12S4/c1-5-43-25-9-7-21(29-19(3)33)15-27(25)47(39,40)31(23-11-13-45(35,36)17-23)32(24-12-14-46(37,38)18-24)48(41,42)28-16-22(30-20(4)34)8-10-26(28)44-6-2/h7-10,15-16,23-24H,5-6,11-14,17-18H2,1-4H3,(H,29,33)(H,30,34) |
| InChIKey | JADWVCQXQBICAM-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 219.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.90 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|