C21H26N2O7S2 — CID 164663208
N-[3-[benzyl-(4-hydroxy-1,1-dioxothiolan-3-yl)sulfamoyl]-4-ethoxyphenyl]acetamide (PubChem CID 164663208) has the molecular formula C21H26N2O7S2 and a molecular weight of 482.58 g/mol. Its IUPAC name is N-[3-[benzyl-(4-hydroxy-1,1-dioxothiolan-3-yl)sulfamoyl]-4-ethoxyphenyl]acetamide.
| Compound Name | N-[3-[benzyl-(4-hydroxy-1,1-dioxothiolan-3-yl)sulfamoyl]-4-ethoxyphenyl]acetamide |
|---|---|
| PubChem CID | 164663208 |
| Molecular Formula | C21H26N2O7S2 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | N-[3-[benzyl-(4-hydroxy-1,1-dioxothiolan-3-yl)sulfamoyl]-4-ethoxyphenyl]acetamide |
| SMILES | CCOc1ccc(NC(C)=O)cc1S(=O)(=O)N(Cc1ccccc1)C1CS(=O)(=O)CC1O |
| InChI | InChI=1S/C21H26N2O7S2/c1-3-30-20-10-9-17(22-15(2)24)11-21(20)32(28,29)23(12-16-7-5-4-6-8-16)18-13-31(26,27)14-19(18)25/h4-11,18-19,25H,3,12-14H2,1-2H3,(H,22,24) |
| InChIKey | MEWPVWMOCWNHCL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |