C17H24ClN3O2S — CID 119976613
3-methyl-N-propyl-N-pyrrolidin-3-ylquinoline-8-sulfonamide;hydrochloride (PubChem CID 119976613) has the molecular formula C17H24ClN3O2S and a molecular weight of 369.92 g/mol. Its IUPAC name is 3-methyl-N-propyl-N-pyrrolidin-3-ylquinoline-8-sulfonamide;hydrochloride.
| Compound Name | 3-methyl-N-propyl-N-pyrrolidin-3-ylquinoline-8-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119976613 |
| Molecular Formula | C17H24ClN3O2S |
| Molecular Weight | 369.92 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 3-methyl-N-propyl-N-pyrrolidin-3-ylquinoline-8-sulfonamide;hydrochloride |
| SMILES | CCCN(C1CCNC1)S(=O)(=O)c1cccc2cc(C)cnc12.Cl |
| InChI | InChI=1S/C17H23N3O2S.ClH/c1-3-9-20(15-7-8-18-12-15)23(21,22)16-6-4-5-14-10-13(2)11-19-17(14)16;/h4-6,10-11,15,18H,3,7-9,12H2,1-2H3;1H |
| InChIKey | UPSFRUWMOSWJLR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.92 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |