C29H31N3O2S — CID 148921004
N-phenyl-N-(2-phenyl-1-piperidin-3-ylpropyl)quinoline-8-sulfonamide (PubChem CID 148921004) has the molecular formula C29H31N3O2S and a molecular weight of 485.65 g/mol. Its IUPAC name is N-phenyl-N-(2-phenyl-1-piperidin-3-ylpropyl)quinoline-8-sulfonamide.
| Compound Name | N-phenyl-N-(2-phenyl-1-piperidin-3-ylpropyl)quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 148921004 |
| Molecular Formula | C29H31N3O2S |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | N-phenyl-N-(2-phenyl-1-piperidin-3-ylpropyl)quinoline-8-sulfonamide |
| SMILES | CC(c1ccccc1)C(C1CCCNC1)N(c1ccccc1)S(=O)(=O)c1cccc2cccnc12 |
| InChI | InChI=1S/C29H31N3O2S/c1-22(23-11-4-2-5-12-23)29(25-15-9-19-30-21-25)32(26-16-6-3-7-17-26)35(33,34)27-18-8-13-24-14-10-20-31-28(24)27/h2-8,10-14,16-18,20,22,25,29-30H,9,15,19,21H2,1H3 |
| InChIKey | GDRAJWDBERTOJW-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |