C17H24N2O2S — CID 4185398
N,N-di(butan-2-yl)quinoline-8-sulfonamide (PubChem CID 4185398) has the molecular formula C17H24N2O2S and a molecular weight of 320.46 g/mol. Its IUPAC name is N,N-di(butan-2-yl)quinoline-8-sulfonamide.
| Compound Name | N,N-di(butan-2-yl)quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 4185398 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | N,N-di(butan-2-yl)quinoline-8-sulfonamide |
| SMILES | CCC(C)N(C(C)CC)S(=O)(=O)c1cccc2cccnc12 |
| InChI | InChI=1S/C17H24N2O2S/c1-5-13(3)19(14(4)6-2)22(20,21)16-11-7-9-15-10-8-12-18-17(15)16/h7-14H,5-6H2,1-4H3 |
| InChIKey | CNHPBZQSLYMITJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |