C18H26N2O2S — CID 23392955
N-(3,3-dimethylbutyl)-N-propylquinoline-8-sulfonamide (PubChem CID 23392955) has the molecular formula C18H26N2O2S and a molecular weight of 334.49 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-N-propylquinoline-8-sulfonamide.
| Compound Name | N-(3,3-dimethylbutyl)-N-propylquinoline-8-sulfonamide |
|---|---|
| PubChem CID | 23392955 |
| Molecular Formula | C18H26N2O2S |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | N-(3,3-dimethylbutyl)-N-propylquinoline-8-sulfonamide |
| SMILES | CCCN(CCC(C)(C)C)S(=O)(=O)c1cccc2cccnc12 |
| InChI | InChI=1S/C18H26N2O2S/c1-5-13-20(14-11-18(2,3)4)23(21,22)16-10-6-8-15-9-7-12-19-17(15)16/h6-10,12H,5,11,13-14H2,1-4H3 |
| InChIKey | XTNDAGPRCXBIEG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |