C15H17F3N2O2S — CID 75372180
N-ethyl-1-quinolin-8-yl-N-(3,3,3-trifluoropropyl)methanesulfonamide (PubChem CID 75372180) has the molecular formula C15H17F3N2O2S and a molecular weight of 346.37 g/mol. Its IUPAC name is N-ethyl-1-quinolin-8-yl-N-(3,3,3-trifluoropropyl)methanesulfonamide.
| Compound Name | N-ethyl-1-quinolin-8-yl-N-(3,3,3-trifluoropropyl)methanesulfonamide |
|---|---|
| PubChem CID | 75372180 |
| Molecular Formula | C15H17F3N2O2S |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | N-ethyl-1-quinolin-8-yl-N-(3,3,3-trifluoropropyl)methanesulfonamide |
| SMILES | CCN(CCC(F)(F)F)S(=O)(=O)Cc1cccc2cccnc12 |
| InChI | InChI=1S/C15H17F3N2O2S/c1-2-20(10-8-15(16,17)18)23(21,22)11-13-6-3-5-12-7-4-9-19-14(12)13/h3-7,9H,2,8,10-11H2,1H3 |
| InChIKey | AFQRXLUQITWPMS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |