C14H16F2N2O2S — CID 56791454
N-(2,2-difluoroethyl)-N-propylquinoline-8-sulfonamide (PubChem CID 56791454) has the molecular formula C14H16F2N2O2S and a molecular weight of 314.36 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N-propylquinoline-8-sulfonamide.
| Compound Name | N-(2,2-difluoroethyl)-N-propylquinoline-8-sulfonamide |
|---|---|
| PubChem CID | 56791454 |
| Molecular Formula | C14H16F2N2O2S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | N-(2,2-difluoroethyl)-N-propylquinoline-8-sulfonamide |
| SMILES | CCCN(CC(F)F)S(=O)(=O)c1cccc2cccnc12 |
| InChI | InChI=1S/C14H16F2N2O2S/c1-2-9-18(10-13(15)16)21(19,20)12-7-3-5-11-6-4-8-17-14(11)12/h3-8,13H,2,9-10H2,1H3 |
| InChIKey | AYQXJWZXIRZQPK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |