C23H20N2O2S — CID 3737417
N,N-bis(4-methylphenyl)quinoline-8-sulfonamide (PubChem CID 3737417) has the molecular formula C23H20N2O2S and a molecular weight of 388.49 g/mol. Its IUPAC name is N,N-bis(4-methylphenyl)quinoline-8-sulfonamide.
| Compound Name | N,N-bis(4-methylphenyl)quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 3737417 |
| Molecular Formula | C23H20N2O2S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | N,N-bis(4-methylphenyl)quinoline-8-sulfonamide |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)S(=O)(=O)c2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C23H20N2O2S/c1-17-8-12-20(13-9-17)25(21-14-10-18(2)11-15-21)28(26,27)22-7-3-5-19-6-4-16-24-23(19)22/h3-16H,1-2H3 |
| InChIKey | ATVAQLBQYQNHEZ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |