C26H25FN2O5S2 — CID 98366170
[4-[[[(2S)-butan-2-yl]-quinolin-8-ylsulfonylamino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 98366170) has the molecular formula C26H25FN2O5S2 and a molecular weight of 528.63 g/mol. Its IUPAC name is [4-[[[(2S)-butan-2-yl]-quinolin-8-ylsulfonylamino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-[[[(2S)-butan-2-yl]-quinolin-8-ylsulfonylamino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 98366170 |
| Molecular Formula | C26H25FN2O5S2 |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | [4-[[[(2S)-butan-2-yl]-quinolin-8-ylsulfonylamino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | CC[C@H](C)N(Cc1ccc(OS(=O)(=O)c2ccc(F)cc2)cc1)S(=O)(=O)c1cccc2cccnc12 |
| InChI | InChI=1S/C26H25FN2O5S2/c1-3-19(2)29(35(30,31)25-8-4-6-21-7-5-17-28-26(21)25)18-20-9-13-23(14-10-20)34-36(32,33)24-15-11-22(27)12-16-24/h4-17,19H,3,18H2,1-2H3/t19-/m0/s1 |
| InChIKey | LFZKDRKXHGJBEZ-IBGZPJMESA-N |
| XLogP | 5.13 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|