C31H30FNO4S — CID 3952767
[4-[[butan-2-yl-(2,2-diphenylacetyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 3952767) has the molecular formula C31H30FNO4S and a molecular weight of 531.65 g/mol. Its IUPAC name is [4-[[butan-2-yl-(2,2-diphenylacetyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-[[butan-2-yl-(2,2-diphenylacetyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 3952767 |
| Molecular Formula | C31H30FNO4S |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | [4-[[butan-2-yl-(2,2-diphenylacetyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | CCC(C)N(Cc1ccc(OS(=O)(=O)c2ccc(F)cc2)cc1)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H30FNO4S/c1-3-23(2)33(31(34)30(25-10-6-4-7-11-25)26-12-8-5-9-13-26)22-24-14-18-28(19-15-24)37-38(35,36)29-20-16-27(32)17-21-29/h4-21,23,30H,3,22H2,1-2H3 |
| InChIKey | ZGNHGPQYEYTNDX-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|