C24H22Cl2FNO4S — CID 3952770
[4-[[butan-2-yl-(3,4-dichlorobenzoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 3952770) has the molecular formula C24H22Cl2FNO4S and a molecular weight of 510.41 g/mol. Its IUPAC name is [4-[[butan-2-yl-(3,4-dichlorobenzoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-[[butan-2-yl-(3,4-dichlorobenzoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 3952770 |
| Molecular Formula | C24H22Cl2FNO4S |
| Molecular Weight | 510.41 g/mol |
| Exact Mass | 509.06 |
| IUPAC Name | [4-[[butan-2-yl-(3,4-dichlorobenzoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | CCC(C)N(Cc1ccc(OS(=O)(=O)c2ccc(F)cc2)cc1)C(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H22Cl2FNO4S/c1-3-16(2)28(24(29)18-6-13-22(25)23(26)14-18)15-17-4-9-20(10-5-17)32-33(30,31)21-11-7-19(27)8-12-21/h4-14,16H,3,15H2,1-2H3 |
| InChIKey | RCHQKJXAYZASMR-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.41 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|