C22H22FNO4S2 — CID 5219274
[4-[[butan-2-yl(thiophene-2-carbonyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 5219274) has the molecular formula C22H22FNO4S2 and a molecular weight of 447.55 g/mol. Its IUPAC name is [4-[[butan-2-yl(thiophene-2-carbonyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-[[butan-2-yl(thiophene-2-carbonyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 5219274 |
| Molecular Formula | C22H22FNO4S2 |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | [4-[[butan-2-yl(thiophene-2-carbonyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | CCC(C)N(Cc1ccc(OS(=O)(=O)c2ccc(F)cc2)cc1)C(=O)c1cccs1 |
| InChI | InChI=1S/C22H22FNO4S2/c1-3-16(2)24(22(25)21-5-4-14-29-21)15-17-6-10-19(11-7-17)28-30(26,27)20-12-8-18(23)9-13-20/h4-14,16H,3,15H2,1-2H3 |
| InChIKey | NYUOFPQJDNNWQS-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|