C26H23F3N2O5S2 — CID 5064565
[4-[[propan-2-yl(quinolin-8-ylsulfonyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 5064565) has the molecular formula C26H23F3N2O5S2 and a molecular weight of 564.61 g/mol. Its IUPAC name is [4-[[propan-2-yl(quinolin-8-ylsulfonyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [4-[[propan-2-yl(quinolin-8-ylsulfonyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 5064565 |
| Molecular Formula | C26H23F3N2O5S2 |
| Molecular Weight | 564.61 g/mol |
| Exact Mass | 564.10 |
| IUPAC Name | [4-[[propan-2-yl(quinolin-8-ylsulfonyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CC(C)N(Cc1ccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1)S(=O)(=O)c1cccc2cccnc12 |
| InChI | InChI=1S/C26H23F3N2O5S2/c1-18(2)31(37(32,33)24-10-3-6-20-7-5-15-30-25(20)24)17-19-11-13-22(14-12-19)36-38(34,35)23-9-4-8-21(16-23)26(27,28)29/h3-16,18H,17H2,1-2H3 |
| InChIKey | IUQIQJKQAWRCBZ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.61 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|