C28H33F3N2O4S — CID 4109789
[4-[[1-adamantylcarbamoyl(propan-2-yl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 4109789) has the molecular formula C28H33F3N2O4S and a molecular weight of 550.64 g/mol. Its IUPAC name is [4-[[1-adamantylcarbamoyl(propan-2-yl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [4-[[1-adamantylcarbamoyl(propan-2-yl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 4109789 |
| Molecular Formula | C28H33F3N2O4S |
| Molecular Weight | 550.64 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | [4-[[1-adamantylcarbamoyl(propan-2-yl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CC(C)N(Cc1ccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C28H33F3N2O4S/c1-18(2)33(26(34)32-27-14-20-10-21(15-27)12-22(11-20)16-27)17-19-6-8-24(9-7-19)37-38(35,36)25-5-3-4-23(13-25)28(29,30)31/h3-9,13,18,20-22H,10-12,14-17H2,1-2H3,(H,32,34) |
| InChIKey | RLLUHVHBSPYYSA-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.64 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|