C25H25F3N2O4S — CID 3538136
[3-[[benzylcarbamoyl(propan-2-yl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 3538136) has the molecular formula C25H25F3N2O4S and a molecular weight of 506.55 g/mol. Its IUPAC name is [3-[[benzylcarbamoyl(propan-2-yl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [3-[[benzylcarbamoyl(propan-2-yl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 3538136 |
| Molecular Formula | C25H25F3N2O4S |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | [3-[[benzylcarbamoyl(propan-2-yl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CC(C)N(Cc1cccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)c1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C25H25F3N2O4S/c1-18(2)30(24(31)29-16-19-8-4-3-5-9-19)17-20-10-6-12-22(14-20)34-35(32,33)23-13-7-11-21(15-23)25(26,27)28/h3-15,18H,16-17H2,1-2H3,(H,29,31) |
| InChIKey | PUCLXNRZDIZMLX-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|