C22H25ClF3NO4S — CID 4098233
[3-[[(3-chloro-2,2-dimethylpropanoyl)-propan-2-ylamino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 4098233) has the molecular formula C22H25ClF3NO4S and a molecular weight of 491.96 g/mol. Its IUPAC name is [3-[[(3-chloro-2,2-dimethylpropanoyl)-propan-2-ylamino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [3-[[(3-chloro-2,2-dimethylpropanoyl)-propan-2-ylamino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 4098233 |
| Molecular Formula | C22H25ClF3NO4S |
| Molecular Weight | 491.96 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | [3-[[(3-chloro-2,2-dimethylpropanoyl)-propan-2-ylamino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CC(C)N(Cc1cccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)c1)C(=O)C(C)(C)CCl |
| InChI | InChI=1S/C22H25ClF3NO4S/c1-15(2)27(20(28)21(3,4)14-23)13-16-7-5-9-18(11-16)31-32(29,30)19-10-6-8-17(12-19)22(24,25)26/h5-12,15H,13-14H2,1-4H3 |
| InChIKey | UWPPSVQPDHDPKI-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.96 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|