C25H23ClF3NO5S — CID 42775390
[3-[[[2-(4-chlorophenoxy)acetyl]-propan-2-ylamino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 42775390) has the molecular formula C25H23ClF3NO5S and a molecular weight of 541.98 g/mol. Its IUPAC name is [3-[[[2-(4-chlorophenoxy)acetyl]-propan-2-ylamino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [3-[[[2-(4-chlorophenoxy)acetyl]-propan-2-ylamino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 42775390 |
| Molecular Formula | C25H23ClF3NO5S |
| Molecular Weight | 541.98 g/mol |
| Exact Mass | 541.09 |
| IUPAC Name | [3-[[[2-(4-chlorophenoxy)acetyl]-propan-2-ylamino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CC(C)N(Cc1cccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)c1)C(=O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H23ClF3NO5S/c1-17(2)30(24(31)16-34-21-11-9-20(26)10-12-21)15-18-5-3-7-22(13-18)35-36(32,33)23-8-4-6-19(14-23)25(27,28)29/h3-14,17H,15-16H2,1-2H3 |
| InChIKey | GRLVYVDYNALJAZ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.98 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|