C27H21ClF3NO6S — CID 5004251
[3-[[[2-(4-chlorophenoxy)acetyl]-(furan-2-ylmethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 5004251) has the molecular formula C27H21ClF3NO6S and a molecular weight of 579.98 g/mol. Its IUPAC name is [3-[[[2-(4-chlorophenoxy)acetyl]-(furan-2-ylmethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [3-[[[2-(4-chlorophenoxy)acetyl]-(furan-2-ylmethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 5004251 |
| Molecular Formula | C27H21ClF3NO6S |
| Molecular Weight | 579.98 g/mol |
| Exact Mass | 579.07 |
| IUPAC Name | [3-[[[2-(4-chlorophenoxy)acetyl]-(furan-2-ylmethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | O=C(COc1ccc(Cl)cc1)N(Cc1cccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)c1)Cc1ccco1 |
| InChI | InChI=1S/C27H21ClF3NO6S/c28-21-9-11-22(12-10-21)37-18-26(33)32(17-24-7-3-13-36-24)16-19-4-1-6-23(14-19)38-39(34,35)25-8-2-5-20(15-25)27(29,30)31/h1-15H,16-18H2 |
| InChIKey | FUYZUASUGKNTCW-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.98 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|