C24H18F3NO6S — CID 71959622
[2-[[furan-2-carbonyl(furan-2-ylmethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 71959622) has the molecular formula C24H18F3NO6S and a molecular weight of 505.47 g/mol. Its IUPAC name is [2-[[furan-2-carbonyl(furan-2-ylmethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [2-[[furan-2-carbonyl(furan-2-ylmethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 71959622 |
| Molecular Formula | C24H18F3NO6S |
| Molecular Weight | 505.47 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | [2-[[furan-2-carbonyl(furan-2-ylmethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | O=C(c1ccco1)N(Cc1ccco1)Cc1ccccc1OS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H18F3NO6S/c25-24(26,27)18-7-3-9-20(14-18)35(30,31)34-21-10-2-1-6-17(21)15-28(16-19-8-4-12-32-19)23(29)22-11-5-13-33-22/h1-14H,15-16H2 |
| InChIKey | OJDKYOXSIWMTRU-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 89.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.47 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|