C24H22F3NO5S — CID 3269757
[3-[[cyclobutanecarbonyl(furan-2-ylmethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 3269757) has the molecular formula C24H22F3NO5S and a molecular weight of 493.50 g/mol. Its IUPAC name is [3-[[cyclobutanecarbonyl(furan-2-ylmethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [3-[[cyclobutanecarbonyl(furan-2-ylmethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 3269757 |
| Molecular Formula | C24H22F3NO5S |
| Molecular Weight | 493.50 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | [3-[[cyclobutanecarbonyl(furan-2-ylmethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | O=C(C1CCC1)N(Cc1cccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)c1)Cc1ccco1 |
| InChI | InChI=1S/C24H22F3NO5S/c25-24(26,27)19-8-3-11-22(14-19)34(30,31)33-20-9-1-5-17(13-20)15-28(16-21-10-4-12-32-21)23(29)18-6-2-7-18/h1,3-5,8-14,18H,2,6-7,15-16H2 |
| InChIKey | PSPDCSBRIGTCDS-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.50 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|