C30H31F3N2O5S — CID 3535926
[4-[[1-adamantylcarbamoyl(furan-2-ylmethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 3535926) has the molecular formula C30H31F3N2O5S and a molecular weight of 588.65 g/mol. Its IUPAC name is [4-[[1-adamantylcarbamoyl(furan-2-ylmethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [4-[[1-adamantylcarbamoyl(furan-2-ylmethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 3535926 |
| Molecular Formula | C30H31F3N2O5S |
| Molecular Weight | 588.65 g/mol |
| Exact Mass | 588.19 |
| IUPAC Name | [4-[[1-adamantylcarbamoyl(furan-2-ylmethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)N(Cc1ccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1)Cc1ccco1 |
| InChI | InChI=1S/C30H31F3N2O5S/c31-30(32,33)24-3-1-5-27(14-24)41(37,38)40-25-8-6-20(7-9-25)18-35(19-26-4-2-10-39-26)28(36)34-29-15-21-11-22(16-29)13-23(12-21)17-29/h1-10,14,21-23H,11-13,15-19H2,(H,34,36) |
| InChIKey | IAMKAQGFXRBWMZ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.65 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|