C22H22F3NO4S — CID 71959259
[4-[[cyclobutanecarbonyl(cyclopropyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 71959259) has the molecular formula C22H22F3NO4S and a molecular weight of 453.48 g/mol. Its IUPAC name is [4-[[cyclobutanecarbonyl(cyclopropyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [4-[[cyclobutanecarbonyl(cyclopropyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 71959259 |
| Molecular Formula | C22H22F3NO4S |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | [4-[[cyclobutanecarbonyl(cyclopropyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | O=C(C1CCC1)N(Cc1ccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1)C1CC1 |
| InChI | InChI=1S/C22H22F3NO4S/c23-22(24,25)17-5-2-6-20(13-17)31(28,29)30-19-11-7-15(8-12-19)14-26(18-9-10-18)21(27)16-3-1-4-16/h2,5-8,11-13,16,18H,1,3-4,9-10,14H2 |
| InChIKey | GTPDVRDNMUTXBC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|