C25H24F3NO5S — CID 3664211
[4-[[2-methoxyethyl-(4-methylbenzoyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 3664211) has the molecular formula C25H24F3NO5S and a molecular weight of 507.53 g/mol. Its IUPAC name is [4-[[2-methoxyethyl-(4-methylbenzoyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [4-[[2-methoxyethyl-(4-methylbenzoyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 3664211 |
| Molecular Formula | C25H24F3NO5S |
| Molecular Weight | 507.53 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | [4-[[2-methoxyethyl-(4-methylbenzoyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | COCCN(Cc1ccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1)C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H24F3NO5S/c1-18-6-10-20(11-7-18)24(30)29(14-15-33-2)17-19-8-12-22(13-9-19)34-35(31,32)23-5-3-4-21(16-23)25(26,27)28/h3-13,16H,14-15,17H2,1-2H3 |
| InChIKey | GITYXHXCXZZAAR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.53 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|