C22H24F3NO4S — CID 71956617
[2-[[cyclobutanecarbonyl(propan-2-yl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 71956617) has the molecular formula C22H24F3NO4S and a molecular weight of 455.50 g/mol. Its IUPAC name is [2-[[cyclobutanecarbonyl(propan-2-yl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [2-[[cyclobutanecarbonyl(propan-2-yl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 71956617 |
| Molecular Formula | C22H24F3NO4S |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | [2-[[cyclobutanecarbonyl(propan-2-yl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CC(C)N(Cc1ccccc1OS(=O)(=O)c1cccc(C(F)(F)F)c1)C(=O)C1CCC1 |
| InChI | InChI=1S/C22H24F3NO4S/c1-15(2)26(21(27)16-8-5-9-16)14-17-7-3-4-12-20(17)30-31(28,29)19-11-6-10-18(13-19)22(23,24)25/h3-4,6-7,10-13,15-16H,5,8-9,14H2,1-2H3 |
| InChIKey | OEWHRTXVOIYYDA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|