C23H27F3N2O5S — CID 97038143
[2-[[[(2S)-oxolan-2-yl]methyl-(propan-2-ylcarbamoyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 97038143) has the molecular formula C23H27F3N2O5S and a molecular weight of 500.54 g/mol. Its IUPAC name is [2-[[[(2S)-oxolan-2-yl]methyl-(propan-2-ylcarbamoyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [2-[[[(2S)-oxolan-2-yl]methyl-(propan-2-ylcarbamoyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 97038143 |
| Molecular Formula | C23H27F3N2O5S |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | [2-[[[(2S)-oxolan-2-yl]methyl-(propan-2-ylcarbamoyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CC(C)NC(=O)N(Cc1ccccc1OS(=O)(=O)c1cccc(C(F)(F)F)c1)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C23H27F3N2O5S/c1-16(2)27-22(29)28(15-19-9-6-12-32-19)14-17-7-3-4-11-21(17)33-34(30,31)20-10-5-8-18(13-20)23(24,25)26/h3-5,7-8,10-11,13,16,19H,6,9,12,14-15H2,1-2H3,(H,27,29)/t19-/m0/s1 |
| InChIKey | QPICBABOUDJHFF-IBGZPJMESA-N |
| XLogP | 4.57 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|