C18H30N4O2 — CID 24712063
1-[[5-amino-2-(dimethylamino)phenyl]methyl]-1-(oxolan-2-ylmethyl)-3-propan-2-ylurea (PubChem CID 24712063) has the molecular formula C18H30N4O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is 1-[[5-amino-2-(dimethylamino)phenyl]methyl]-1-(oxolan-2-ylmethyl)-3-propan-2-ylurea.
| Compound Name | 1-[[5-amino-2-(dimethylamino)phenyl]methyl]-1-(oxolan-2-ylmethyl)-3-propan-2-ylurea |
|---|---|
| PubChem CID | 24712063 |
| Molecular Formula | C18H30N4O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | 1-[[5-amino-2-(dimethylamino)phenyl]methyl]-1-(oxolan-2-ylmethyl)-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)N(Cc1cc(N)ccc1N(C)C)CC1CCCO1 |
| InChI | InChI=1S/C18H30N4O2/c1-13(2)20-18(23)22(12-16-6-5-9-24-16)11-14-10-15(19)7-8-17(14)21(3)4/h7-8,10,13,16H,5-6,9,11-12,19H2,1-4H3,(H,20,23) |
| InChIKey | HPUDUGHIJTUATD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|