C24H30ClN3O6S — CID 93304499
[4-chloro-2-[[[(2S)-oxolan-2-yl]methyl-(propan-2-ylcarbamoyl)amino]methyl]phenyl] 4-acetamidobenzenesulfonate (PubChem CID 93304499) has the molecular formula C24H30ClN3O6S and a molecular weight of 524.04 g/mol. Its IUPAC name is [4-chloro-2-[[[(2S)-oxolan-2-yl]methyl-(propan-2-ylcarbamoyl)amino]methyl]phenyl] 4-acetamidobenzenesulfonate.
| Compound Name | [4-chloro-2-[[[(2S)-oxolan-2-yl]methyl-(propan-2-ylcarbamoyl)amino]methyl]phenyl] 4-acetamidobenzenesulfonate |
|---|---|
| PubChem CID | 93304499 |
| Molecular Formula | C24H30ClN3O6S |
| Molecular Weight | 524.04 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | [4-chloro-2-[[[(2S)-oxolan-2-yl]methyl-(propan-2-ylcarbamoyl)amino]methyl]phenyl] 4-acetamidobenzenesulfonate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Oc2ccc(Cl)cc2CN(C[C@@H]2CCCO2)C(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C24H30ClN3O6S/c1-16(2)26-24(30)28(15-21-5-4-12-33-21)14-18-13-19(25)6-11-23(18)34-35(31,32)22-9-7-20(8-10-22)27-17(3)29/h6-11,13,16,21H,4-5,12,14-15H2,1-3H3,(H,26,30)(H,27,29)/t21-/m0/s1 |
| InChIKey | GMRYEVZJDBZNJP-NRFANRHFSA-N |
| XLogP | 4.17 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.04 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|