C26H35N3O7S — CID 93301886
[5-[[tert-butylcarbamoyl-[[(2R)-oxolan-2-yl]methyl]amino]methyl]-2-methoxyphenyl] 4-acetamidobenzenesulfonate (PubChem CID 93301886) has the molecular formula C26H35N3O7S and a molecular weight of 533.65 g/mol. Its IUPAC name is [5-[[tert-butylcarbamoyl-[[(2R)-oxolan-2-yl]methyl]amino]methyl]-2-methoxyphenyl] 4-acetamidobenzenesulfonate.
| Compound Name | [5-[[tert-butylcarbamoyl-[[(2R)-oxolan-2-yl]methyl]amino]methyl]-2-methoxyphenyl] 4-acetamidobenzenesulfonate |
|---|---|
| PubChem CID | 93301886 |
| Molecular Formula | C26H35N3O7S |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | [5-[[tert-butylcarbamoyl-[[(2R)-oxolan-2-yl]methyl]amino]methyl]-2-methoxyphenyl] 4-acetamidobenzenesulfonate |
| SMILES | COc1ccc(CN(C[C@H]2CCCO2)C(=O)NC(C)(C)C)cc1OS(=O)(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C26H35N3O7S/c1-18(30)27-20-9-11-22(12-10-20)37(32,33)36-24-15-19(8-13-23(24)34-5)16-29(17-21-7-6-14-35-21)25(31)28-26(2,3)4/h8-13,15,21H,6-7,14,16-17H2,1-5H3,(H,27,30)(H,28,31)/t21-/m1/s1 |
| InChIKey | XVOIRXUMFOOUMM-OAQYLSRUSA-N |
| XLogP | 3.91 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|