C20H27F3N2O6 — CID 42554582
methyl (2S)-2-acetamido-2-[(3,4-dimethoxyphenyl)methyl-[[(2S)-oxolan-2-yl]methyl]amino]-3,3,3-trifluoropropanoate (PubChem CID 42554582) has the molecular formula C20H27F3N2O6 and a molecular weight of 448.44 g/mol. Its IUPAC name is methyl (2S)-2-acetamido-2-[(3,4-dimethoxyphenyl)methyl-[[(2S)-oxolan-2-yl]methyl]amino]-3,3,3-trifluoropropanoate.
| Compound Name | methyl (2S)-2-acetamido-2-[(3,4-dimethoxyphenyl)methyl-[[(2S)-oxolan-2-yl]methyl]amino]-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 42554582 |
| Molecular Formula | C20H27F3N2O6 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | methyl (2S)-2-acetamido-2-[(3,4-dimethoxyphenyl)methyl-[[(2S)-oxolan-2-yl]methyl]amino]-3,3,3-trifluoropropanoate |
| SMILES | COC(=O)[C@](NC(C)=O)(N(Cc1ccc(OC)c(OC)c1)C[C@@H]1CCCO1)C(F)(F)F |
| InChI | InChI=1S/C20H27F3N2O6/c1-13(26)24-19(18(27)30-4,20(21,22)23)25(12-15-6-5-9-31-15)11-14-7-8-16(28-2)17(10-14)29-3/h7-8,10,15H,5-6,9,11-12H2,1-4H3,(H,24,26)/t15-,19-/m0/s1 |
| InChIKey | LGBCFKQRFMNWSL-KXBFYZLASA-N |
| XLogP | 2.25 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|