C24H30N2O8S — CID 93301861
[2-methoxy-5-[[(2-methoxyacetyl)-[[(2S)-oxolan-2-yl]methyl]amino]methyl]phenyl] 4-acetamidobenzenesulfonate (PubChem CID 93301861) has the molecular formula C24H30N2O8S and a molecular weight of 506.58 g/mol. Its IUPAC name is [2-methoxy-5-[[(2-methoxyacetyl)-[[(2S)-oxolan-2-yl]methyl]amino]methyl]phenyl] 4-acetamidobenzenesulfonate.
| Compound Name | [2-methoxy-5-[[(2-methoxyacetyl)-[[(2S)-oxolan-2-yl]methyl]amino]methyl]phenyl] 4-acetamidobenzenesulfonate |
|---|---|
| PubChem CID | 93301861 |
| Molecular Formula | C24H30N2O8S |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | [2-methoxy-5-[[(2-methoxyacetyl)-[[(2S)-oxolan-2-yl]methyl]amino]methyl]phenyl] 4-acetamidobenzenesulfonate |
| SMILES | COCC(=O)N(Cc1ccc(OC)c(OS(=O)(=O)c2ccc(NC(C)=O)cc2)c1)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C24H30N2O8S/c1-17(27)25-19-7-9-21(10-8-19)35(29,30)34-23-13-18(6-11-22(23)32-3)14-26(24(28)16-31-2)15-20-5-4-12-33-20/h6-11,13,20H,4-5,12,14-16H2,1-3H3,(H,25,27)/t20-/m0/s1 |
| InChIKey | XMYHSYKJQSJDQH-FQEVSTJZSA-N |
| XLogP | 2.58 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|