C23H29ClN2O5S — CID 46135721
[4-chloro-2-[[2-methylpropanoyl(2-methylpropyl)amino]methyl]phenyl] 4-acetamidobenzenesulfonate (PubChem CID 46135721) has the molecular formula C23H29ClN2O5S and a molecular weight of 481.01 g/mol. Its IUPAC name is [4-chloro-2-[[2-methylpropanoyl(2-methylpropyl)amino]methyl]phenyl] 4-acetamidobenzenesulfonate.
| Compound Name | [4-chloro-2-[[2-methylpropanoyl(2-methylpropyl)amino]methyl]phenyl] 4-acetamidobenzenesulfonate |
|---|---|
| PubChem CID | 46135721 |
| Molecular Formula | C23H29ClN2O5S |
| Molecular Weight | 481.01 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | [4-chloro-2-[[2-methylpropanoyl(2-methylpropyl)amino]methyl]phenyl] 4-acetamidobenzenesulfonate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Oc2ccc(Cl)cc2CN(CC(C)C)C(=O)C(C)C)cc1 |
| InChI | InChI=1S/C23H29ClN2O5S/c1-15(2)13-26(23(28)16(3)4)14-18-12-19(24)6-11-22(18)31-32(29,30)21-9-7-20(8-10-21)25-17(5)27/h6-12,15-16H,13-14H2,1-5H3,(H,25,27) |
| InChIKey | XQZKNZOLFVBVDZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.01 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|