C27H28ClN3O6S — CID 71956890
[4-chloro-2-[[cyclopropylmethyl-[(2-methoxyphenyl)carbamoyl]amino]methyl]phenyl] 4-acetamidobenzenesulfonate (PubChem CID 71956890) has the molecular formula C27H28ClN3O6S and a molecular weight of 558.06 g/mol. Its IUPAC name is [4-chloro-2-[[cyclopropylmethyl-[(2-methoxyphenyl)carbamoyl]amino]methyl]phenyl] 4-acetamidobenzenesulfonate.
| Compound Name | [4-chloro-2-[[cyclopropylmethyl-[(2-methoxyphenyl)carbamoyl]amino]methyl]phenyl] 4-acetamidobenzenesulfonate |
|---|---|
| PubChem CID | 71956890 |
| Molecular Formula | C27H28ClN3O6S |
| Molecular Weight | 558.06 g/mol |
| Exact Mass | 557.14 |
| IUPAC Name | [4-chloro-2-[[cyclopropylmethyl-[(2-methoxyphenyl)carbamoyl]amino]methyl]phenyl] 4-acetamidobenzenesulfonate |
| SMILES | COc1ccccc1NC(=O)N(Cc1cc(Cl)ccc1OS(=O)(=O)c1ccc(NC(C)=O)cc1)CC1CC1 |
| InChI | InChI=1S/C27H28ClN3O6S/c1-18(32)29-22-10-12-23(13-11-22)38(34,35)37-25-14-9-21(28)15-20(25)17-31(16-19-7-8-19)27(33)30-24-5-3-4-6-26(24)36-2/h3-6,9-15,19H,7-8,16-17H2,1-2H3,(H,29,32)(H,30,33) |
| InChIKey | KRXHAGAJXPXFFW-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.06 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|