C23H24ClN3O6S — CID 71955427
[4-chloro-2-[[ethylcarbamoyl(furan-2-ylmethyl)amino]methyl]phenyl] 4-acetamidobenzenesulfonate (PubChem CID 71955427) has the molecular formula C23H24ClN3O6S and a molecular weight of 505.98 g/mol. Its IUPAC name is [4-chloro-2-[[ethylcarbamoyl(furan-2-ylmethyl)amino]methyl]phenyl] 4-acetamidobenzenesulfonate.
| Compound Name | [4-chloro-2-[[ethylcarbamoyl(furan-2-ylmethyl)amino]methyl]phenyl] 4-acetamidobenzenesulfonate |
|---|---|
| PubChem CID | 71955427 |
| Molecular Formula | C23H24ClN3O6S |
| Molecular Weight | 505.98 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | [4-chloro-2-[[ethylcarbamoyl(furan-2-ylmethyl)amino]methyl]phenyl] 4-acetamidobenzenesulfonate |
| SMILES | CCNC(=O)N(Cc1ccco1)Cc1cc(Cl)ccc1OS(=O)(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C23H24ClN3O6S/c1-3-25-23(29)27(15-20-5-4-12-32-20)14-17-13-18(24)6-11-22(17)33-34(30,31)21-9-7-19(8-10-21)26-16(2)28/h4-13H,3,14-15H2,1-2H3,(H,25,29)(H,26,28) |
| InChIKey | IHNZDBINVMXIEO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.98 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|