C26H30N2O6S — CID 46135284
[2-[[3,3-dimethylbutanoyl(furan-2-ylmethyl)amino]methyl]phenyl] 4-acetamidobenzenesulfonate (PubChem CID 46135284) has the molecular formula C26H30N2O6S and a molecular weight of 498.60 g/mol. Its IUPAC name is [2-[[3,3-dimethylbutanoyl(furan-2-ylmethyl)amino]methyl]phenyl] 4-acetamidobenzenesulfonate.
| Compound Name | [2-[[3,3-dimethylbutanoyl(furan-2-ylmethyl)amino]methyl]phenyl] 4-acetamidobenzenesulfonate |
|---|---|
| PubChem CID | 46135284 |
| Molecular Formula | C26H30N2O6S |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | [2-[[3,3-dimethylbutanoyl(furan-2-ylmethyl)amino]methyl]phenyl] 4-acetamidobenzenesulfonate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Oc2ccccc2CN(Cc2ccco2)C(=O)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C26H30N2O6S/c1-19(29)27-21-11-13-23(14-12-21)35(31,32)34-24-10-6-5-8-20(24)17-28(18-22-9-7-15-33-22)25(30)16-26(2,3)4/h5-15H,16-18H2,1-4H3,(H,27,29) |
| InChIKey | YRCFXZLXHMBJQV-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|