C21H23N3O6S — CID 39408255
(2S)-2-[(4-acetamidophenyl)sulfonylamino]-N,N-bis(furan-2-ylmethyl)propanamide (PubChem CID 39408255) has the molecular formula C21H23N3O6S and a molecular weight of 445.50 g/mol. Its IUPAC name is (2S)-2-[(4-acetamidophenyl)sulfonylamino]-N,N-bis(furan-2-ylmethyl)propanamide.
| Compound Name | (2S)-2-[(4-acetamidophenyl)sulfonylamino]-N,N-bis(furan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 39408255 |
| Molecular Formula | C21H23N3O6S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | (2S)-2-[(4-acetamidophenyl)sulfonylamino]-N,N-bis(furan-2-ylmethyl)propanamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N[C@@H](C)C(=O)N(Cc2ccco2)Cc2ccco2)cc1 |
| InChI | InChI=1S/C21H23N3O6S/c1-15(23-31(27,28)20-9-7-17(8-10-20)22-16(2)25)21(26)24(13-18-5-3-11-29-18)14-19-6-4-12-30-19/h3-12,15,23H,13-14H2,1-2H3,(H,22,25)/t15-/m0/s1 |
| InChIKey | GEJPACCAIWALLY-HNNXBMFYSA-N |
| XLogP | 2.73 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |