C15H21N3O6S — CID 119208731
2-[2-[(4-acetamidophenyl)sulfonylamino]propanoyl-methylamino]propanoic acid (PubChem CID 119208731) has the molecular formula C15H21N3O6S and a molecular weight of 371.42 g/mol. Its IUPAC name is 2-[2-[(4-acetamidophenyl)sulfonylamino]propanoyl-methylamino]propanoic acid.
| Compound Name | 2-[2-[(4-acetamidophenyl)sulfonylamino]propanoyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 119208731 |
| Molecular Formula | C15H21N3O6S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 2-[2-[(4-acetamidophenyl)sulfonylamino]propanoyl-methylamino]propanoic acid |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NC(C)C(=O)N(C)C(C)C(=O)O)cc1 |
| InChI | InChI=1S/C15H21N3O6S/c1-9(14(20)18(4)10(2)15(21)22)17-25(23,24)13-7-5-12(6-8-13)16-11(3)19/h5-10,17H,1-4H3,(H,16,19)(H,21,22) |
| InChIKey | VDBMVKAHBFVEFP-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |