C25H34N2O5S — CID 93301897
[2-[[[(2R)-butan-2-yl]-(3,3-dimethylbutanoyl)amino]methyl]phenyl] 4-acetamidobenzenesulfonate (PubChem CID 93301897) has the molecular formula C25H34N2O5S and a molecular weight of 474.62 g/mol. Its IUPAC name is [2-[[[(2R)-butan-2-yl]-(3,3-dimethylbutanoyl)amino]methyl]phenyl] 4-acetamidobenzenesulfonate.
| Compound Name | [2-[[[(2R)-butan-2-yl]-(3,3-dimethylbutanoyl)amino]methyl]phenyl] 4-acetamidobenzenesulfonate |
|---|---|
| PubChem CID | 93301897 |
| Molecular Formula | C25H34N2O5S |
| Molecular Weight | 474.62 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | [2-[[[(2R)-butan-2-yl]-(3,3-dimethylbutanoyl)amino]methyl]phenyl] 4-acetamidobenzenesulfonate |
| SMILES | CC[C@@H](C)N(Cc1ccccc1OS(=O)(=O)c1ccc(NC(C)=O)cc1)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C25H34N2O5S/c1-7-18(2)27(24(29)16-25(4,5)6)17-20-10-8-9-11-23(20)32-33(30,31)22-14-12-21(13-15-22)26-19(3)28/h8-15,18H,7,16-17H2,1-6H3,(H,26,28)/t18-/m1/s1 |
| InChIKey | NQXWNHVUXWFMMK-GOSISDBHSA-N |
| XLogP | 4.98 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.62 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|