C28H39N3O5S — CID 46135758
[2-[[butan-2-yl(cyclobutanecarbonyl)amino]methyl]-5-(diethylamino)phenyl] 4-acetamidobenzenesulfonate (PubChem CID 46135758) has the molecular formula C28H39N3O5S and a molecular weight of 529.70 g/mol. Its IUPAC name is [2-[[butan-2-yl(cyclobutanecarbonyl)amino]methyl]-5-(diethylamino)phenyl] 4-acetamidobenzenesulfonate.
| Compound Name | [2-[[butan-2-yl(cyclobutanecarbonyl)amino]methyl]-5-(diethylamino)phenyl] 4-acetamidobenzenesulfonate |
|---|---|
| PubChem CID | 46135758 |
| Molecular Formula | C28H39N3O5S |
| Molecular Weight | 529.70 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | [2-[[butan-2-yl(cyclobutanecarbonyl)amino]methyl]-5-(diethylamino)phenyl] 4-acetamidobenzenesulfonate |
| SMILES | CCC(C)N(Cc1ccc(N(CC)CC)cc1OS(=O)(=O)c1ccc(NC(C)=O)cc1)C(=O)C1CCC1 |
| InChI | InChI=1S/C28H39N3O5S/c1-6-20(4)31(28(33)22-10-9-11-22)19-23-12-15-25(30(7-2)8-3)18-27(23)36-37(34,35)26-16-13-24(14-17-26)29-21(5)32/h12-18,20,22H,6-11,19H2,1-5H3,(H,29,32) |
| InChIKey | ITMZMQISIFKDIV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.70 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|