C20H35N3O4S — CID 42812166
[2-[[butan-2-yl(propan-2-ylcarbamoyl)amino]methyl]-5-(diethylamino)phenyl] methanesulfonate (PubChem CID 42812166) has the molecular formula C20H35N3O4S and a molecular weight of 413.58 g/mol. Its IUPAC name is [2-[[butan-2-yl(propan-2-ylcarbamoyl)amino]methyl]-5-(diethylamino)phenyl] methanesulfonate.
| Compound Name | [2-[[butan-2-yl(propan-2-ylcarbamoyl)amino]methyl]-5-(diethylamino)phenyl] methanesulfonate |
|---|---|
| PubChem CID | 42812166 |
| Molecular Formula | C20H35N3O4S |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | [2-[[butan-2-yl(propan-2-ylcarbamoyl)amino]methyl]-5-(diethylamino)phenyl] methanesulfonate |
| SMILES | CCC(C)N(Cc1ccc(N(CC)CC)cc1OS(C)(=O)=O)C(=O)NC(C)C |
| InChI | InChI=1S/C20H35N3O4S/c1-8-16(6)23(20(24)21-15(4)5)14-17-11-12-18(22(9-2)10-3)13-19(17)27-28(7,25)26/h11-13,15-16H,8-10,14H2,1-7H3,(H,21,24) |
| InChIKey | JFXSIOGIFVVXFO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|