C28H31Cl2FN2O4S — CID 98370645
[2-[[[(2S)-butan-2-yl]-(3-fluorobenzoyl)amino]methyl]-5-(diethylamino)phenyl] 3,4-dichlorobenzenesulfonate (PubChem CID 98370645) has the molecular formula C28H31Cl2FN2O4S and a molecular weight of 581.54 g/mol. Its IUPAC name is [2-[[[(2S)-butan-2-yl]-(3-fluorobenzoyl)amino]methyl]-5-(diethylamino)phenyl] 3,4-dichlorobenzenesulfonate.
| Compound Name | [2-[[[(2S)-butan-2-yl]-(3-fluorobenzoyl)amino]methyl]-5-(diethylamino)phenyl] 3,4-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 98370645 |
| Molecular Formula | C28H31Cl2FN2O4S |
| Molecular Weight | 581.54 g/mol |
| Exact Mass | 580.14 |
| IUPAC Name | [2-[[[(2S)-butan-2-yl]-(3-fluorobenzoyl)amino]methyl]-5-(diethylamino)phenyl] 3,4-dichlorobenzenesulfonate |
| SMILES | CC[C@H](C)N(Cc1ccc(N(CC)CC)cc1OS(=O)(=O)c1ccc(Cl)c(Cl)c1)C(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C28H31Cl2FN2O4S/c1-5-19(4)33(28(34)20-9-8-10-22(31)15-20)18-21-11-12-23(32(6-2)7-3)16-27(21)37-38(35,36)24-13-14-25(29)26(30)17-24/h8-17,19H,5-7,18H2,1-4H3/t19-/m0/s1 |
| InChIKey | YSDBSIPWVUAAOU-IBGZPJMESA-N |
| XLogP | 7.19 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.54 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|