C26H30Cl2N2O5S — CID 83272742
[5-(diethylamino)-2-[[furan-2-carbonyl(2-methylpropyl)amino]methyl]phenyl] 3,4-dichlorobenzenesulfonate (PubChem CID 83272742) has the molecular formula C26H30Cl2N2O5S and a molecular weight of 553.51 g/mol. Its IUPAC name is [5-(diethylamino)-2-[[furan-2-carbonyl(2-methylpropyl)amino]methyl]phenyl] 3,4-dichlorobenzenesulfonate.
| Compound Name | [5-(diethylamino)-2-[[furan-2-carbonyl(2-methylpropyl)amino]methyl]phenyl] 3,4-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 83272742 |
| Molecular Formula | C26H30Cl2N2O5S |
| Molecular Weight | 553.51 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | [5-(diethylamino)-2-[[furan-2-carbonyl(2-methylpropyl)amino]methyl]phenyl] 3,4-dichlorobenzenesulfonate |
| SMILES | CCN(CC)c1ccc(CN(CC(C)C)C(=O)c2ccco2)c(OS(=O)(=O)c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C26H30Cl2N2O5S/c1-5-29(6-2)20-10-9-19(17-30(16-18(3)4)26(31)24-8-7-13-34-24)25(14-20)35-36(32,33)21-11-12-22(27)23(28)15-21/h7-15,18H,5-6,16-17H2,1-4H3 |
| InChIKey | KVWPBDUJSZMLRO-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.51 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|