C21H30N2O4S2 — CID 42812136
[5-(diethylamino)-2-[[2-methylpropyl(thiophene-2-carbonyl)amino]methyl]phenyl] methanesulfonate (PubChem CID 42812136) has the molecular formula C21H30N2O4S2 and a molecular weight of 438.62 g/mol. Its IUPAC name is [5-(diethylamino)-2-[[2-methylpropyl(thiophene-2-carbonyl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [5-(diethylamino)-2-[[2-methylpropyl(thiophene-2-carbonyl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 42812136 |
| Molecular Formula | C21H30N2O4S2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | [5-(diethylamino)-2-[[2-methylpropyl(thiophene-2-carbonyl)amino]methyl]phenyl] methanesulfonate |
| SMILES | CCN(CC)c1ccc(CN(CC(C)C)C(=O)c2cccs2)c(OS(C)(=O)=O)c1 |
| InChI | InChI=1S/C21H30N2O4S2/c1-6-22(7-2)18-11-10-17(19(13-18)27-29(5,25)26)15-23(14-16(3)4)21(24)20-9-8-12-28-20/h8-13,16H,6-7,14-15H2,1-5H3 |
| InChIKey | HQVKWMIEQRMIBP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|